Pegaptanib
| Clinical data | |
|---|---|
| Trade names | Macugen |
| AHFS/Drugs.com | Monograph |
| MedlinePlus | a607057 |
| Routes of administration | Intravitreal injection |
| ATC code | |
| Legal status | |
| Legal status |
|
| Pharmacokinetic data | |
| Elimination half-life | 10 days |
| Identifiers | |
IUPAC name
| |
| CAS Number | |
| DrugBank | |
| ChemSpider |
|
| UNII | |
| CompTox Dashboard (EPA) | |
| Chemical and physical data | |
| Formula | C294H342F13N107Na28O188P28[C2H4O](m+n) (m+n≈900) |
| Molar mass | ~50 kg/mol |
| (verify) | |
Pegaptanib sodium injection (brand name Macugen) is an anti-angiogenic medicine for the treatment of neovascular (wet) age-related macular degeneration (AMD). It was discovered by NeXstar Pharmaceuticals (which merged with Gilead Sciences in 1999) and licensed in 2000 to EyeTech Pharmaceuticals, now OSI Pharmaceuticals, for late stage development and marketing in the United States. Gilead Sciences continues to receive royalties from the drugs licensing. Outside the US pegaptanib is marketed by Pfizer. Approval was granted by the U.S. Food and Drug Administration (FDA) in December 2004.